C16H15F6N3O3 — CID 7298513
(5R)-5-piperidin-1-yl-3-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)imidazolidine-2,4-dione (PubChem CID 7298513) has the molecular formula C16H15F6N3O3 and a molecular weight of 411.30 g/mol. Its IUPAC name is (5R)-5-piperidin-1-yl-3-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)imidazolidine-2,4-dione.
| Compound Name | (5R)-5-piperidin-1-yl-3-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7298513 |
| Molecular Formula | C16H15F6N3O3 |
| Molecular Weight | 411.30 g/mol |
| Exact Mass | 411.10 |
| IUPAC Name | (5R)-5-piperidin-1-yl-3-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)imidazolidine-2,4-dione |
| SMILES | O=C1N[C@](N2CCCCC2)(C(F)(F)F)C(=O)N1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H15F6N3O3/c17-15(18,19)14(24-8-2-1-3-9-24)12(26)25(13(27)23-14)10-4-6-11(7-5-10)28-16(20,21)22/h4-7H,1-3,8-9H2,(H,23,27)/t14-/m1/s1 |
| InChIKey | XXGQCTNAWBCHPM-CQSZACIVSA-N |
| XLogP | 3.39 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.30 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|