C18H10F7N3O4 — CID 4275035
N-[2,5-dioxo-1-[4-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)imidazolidin-4-yl]-4-fluorobenzamide (PubChem CID 4275035) has the molecular formula C18H10F7N3O4 and a molecular weight of 465.28 g/mol. Its IUPAC name is N-[2,5-dioxo-1-[4-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)imidazolidin-4-yl]-4-fluorobenzamide.
| Compound Name | N-[2,5-dioxo-1-[4-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)imidazolidin-4-yl]-4-fluorobenzamide |
|---|---|
| PubChem CID | 4275035 |
| Molecular Formula | C18H10F7N3O4 |
| Molecular Weight | 465.28 g/mol |
| Exact Mass | 465.06 |
| IUPAC Name | N-[2,5-dioxo-1-[4-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)imidazolidin-4-yl]-4-fluorobenzamide |
| SMILES | O=C(NC1(C(F)(F)F)NC(=O)N(c2ccc(OC(F)(F)F)cc2)C1=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C18H10F7N3O4/c19-10-3-1-9(2-4-10)13(29)26-16(17(20,21)22)14(30)28(15(31)27-16)11-5-7-12(8-6-11)32-18(23,24)25/h1-8H,(H,26,29)(H,27,31) |
| InChIKey | SEWLSQCBQWMMFN-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.28 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|