C16H18F3N3O4 — CID 2217182
N-[(4S)-1-(4-methoxyphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2,2-dimethylpropanamide (PubChem CID 2217182) has the molecular formula C16H18F3N3O4 and a molecular weight of 373.33 g/mol. Its IUPAC name is N-[(4S)-1-(4-methoxyphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2,2-dimethylpropanamide.
| Compound Name | N-[(4S)-1-(4-methoxyphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 2217182 |
| Molecular Formula | C16H18F3N3O4 |
| Molecular Weight | 373.33 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | N-[(4S)-1-(4-methoxyphenyl)-2,5-dioxo-4-(trifluoromethyl)imidazolidin-4-yl]-2,2-dimethylpropanamide |
| SMILES | COc1ccc(N2C(=O)N[C@](NC(=O)C(C)(C)C)(C(F)(F)F)C2=O)cc1 |
| InChI | InChI=1S/C16H18F3N3O4/c1-14(2,3)11(23)20-15(16(17,18)19)12(24)22(13(25)21-15)9-5-7-10(26-4)8-6-9/h5-8H,1-4H3,(H,20,23)(H,21,25)/t15-/m0/s1 |
| InChIKey | GPSLSUJSAHLGSY-HNNXBMFYSA-N |
| XLogP | 2.17 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.33 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|