C18H13F6N3O4 — CID 40844971
(5S)-5-(4-methoxyanilino)-3-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)imidazolidine-2,4-dione (PubChem CID 40844971) has the molecular formula C18H13F6N3O4 and a molecular weight of 449.31 g/mol. Its IUPAC name is (5S)-5-(4-methoxyanilino)-3-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(4-methoxyanilino)-3-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 40844971 |
| Molecular Formula | C18H13F6N3O4 |
| Molecular Weight | 449.31 g/mol |
| Exact Mass | 449.08 |
| IUPAC Name | (5S)-5-(4-methoxyanilino)-3-[4-(trifluoromethoxy)phenyl]-5-(trifluoromethyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc(N[C@]2(C(F)(F)F)NC(=O)N(c3ccc(OC(F)(F)F)cc3)C2=O)cc1 |
| InChI | InChI=1S/C18H13F6N3O4/c1-30-12-6-2-10(3-7-12)25-16(17(19,20)21)14(28)27(15(29)26-16)11-4-8-13(9-5-11)31-18(22,23)24/h2-9,25H,1H3,(H,26,29)/t16-/m0/s1 |
| InChIKey | MCLCZZCOBFYQFT-INIZCTEOSA-N |
| XLogP | 4.02 |
| TPSA | 79.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.31 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|