C16H9F6N3O5 — CID 42558547
N-[(4S)-2,5-dioxo-1-[4-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)imidazolidin-4-yl]furan-2-carboxamide (PubChem CID 42558547) has the molecular formula C16H9F6N3O5 and a molecular weight of 437.25 g/mol. Its IUPAC name is N-[(4S)-2,5-dioxo-1-[4-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)imidazolidin-4-yl]furan-2-carboxamide.
| Compound Name | N-[(4S)-2,5-dioxo-1-[4-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)imidazolidin-4-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 42558547 |
| Molecular Formula | C16H9F6N3O5 |
| Molecular Weight | 437.25 g/mol |
| Exact Mass | 437.04 |
| IUPAC Name | N-[(4S)-2,5-dioxo-1-[4-(trifluoromethoxy)phenyl]-4-(trifluoromethyl)imidazolidin-4-yl]furan-2-carboxamide |
| SMILES | O=C(N[C@]1(C(F)(F)F)NC(=O)N(c2ccc(OC(F)(F)F)cc2)C1=O)c1ccco1 |
| InChI | InChI=1S/C16H9F6N3O5/c17-15(18,19)14(23-11(26)10-2-1-7-29-10)12(27)25(13(28)24-14)8-3-5-9(6-4-8)30-16(20,21)22/h1-7H,(H,23,26)(H,24,28)/t14-/m0/s1 |
| InChIKey | YHEJQEMBXIXYIJ-AWEZNQCLSA-N |
| XLogP | 2.92 |
| TPSA | 100.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.25 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|