C11H8F3NO2 — CID 171061640
4-methylidene-1-[4-(trifluoromethoxy)phenyl]azetidin-2-one (PubChem CID 171061640) has the molecular formula C11H8F3NO2 and a molecular weight of 243.18 g/mol. Its IUPAC name is 4-methylidene-1-[4-(trifluoromethoxy)phenyl]azetidin-2-one.
| Compound Name | 4-methylidene-1-[4-(trifluoromethoxy)phenyl]azetidin-2-one |
|---|---|
| PubChem CID | 171061640 |
| Molecular Formula | C11H8F3NO2 |
| Molecular Weight | 243.18 g/mol |
| Exact Mass | 243.05 |
| IUPAC Name | 4-methylidene-1-[4-(trifluoromethoxy)phenyl]azetidin-2-one |
| SMILES | C=C1CC(=O)N1c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H8F3NO2/c1-7-6-10(16)15(7)8-2-4-9(5-3-8)17-11(12,13)14/h2-5H,1,6H2 |
| InChIKey | YKYBHNLKQXXCND-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.18 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |