C9H6F3N3O2S — CID 25196619
5-sulfanylidene-4-[4-(trifluoromethoxy)phenyl]-1,2,4-triazolidin-3-one (PubChem CID 25196619) has the molecular formula C9H6F3N3O2S and a molecular weight of 277.23 g/mol. Its IUPAC name is 5-sulfanylidene-4-[4-(trifluoromethoxy)phenyl]-1,2,4-triazolidin-3-one.
| Compound Name | 5-sulfanylidene-4-[4-(trifluoromethoxy)phenyl]-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 25196619 |
| Molecular Formula | C9H6F3N3O2S |
| Molecular Weight | 277.23 g/mol |
| Exact Mass | 277.01 |
| IUPAC Name | 5-sulfanylidene-4-[4-(trifluoromethoxy)phenyl]-1,2,4-triazolidin-3-one |
| SMILES | O=c1[nH][nH]c(=S)n1-c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C9H6F3N3O2S/c10-9(11,12)17-6-3-1-5(2-4-6)15-7(16)13-14-8(15)18/h1-4H,(H,13,16)(H,14,18) |
| InChIKey | PRUDXWICMDGQPA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 62.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.23 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|