C10H6F3N3O2 — CID 126645592
1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazole-3-carbaldehyde (PubChem CID 126645592) has the molecular formula C10H6F3N3O2 and a molecular weight of 257.17 g/mol. Its IUPAC name is 1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazole-3-carbaldehyde.
| Compound Name | 1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazole-3-carbaldehyde |
|---|---|
| PubChem CID | 126645592 |
| Molecular Formula | C10H6F3N3O2 |
| Molecular Weight | 257.17 g/mol |
| Exact Mass | 257.04 |
| IUPAC Name | 1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazole-3-carbaldehyde |
| SMILES | O=Cc1ncn(-c2ccc(OC(F)(F)F)cc2)n1 |
| InChI | InChI=1S/C10H6F3N3O2/c11-10(12,13)18-8-3-1-7(2-4-8)16-6-14-9(5-17)15-16/h1-6H |
| InChIKey | QRMOVZZTILUKRB-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.17 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|