C19H15F3N4O3 — CID 175151333
methyl 2-amino-5-[2-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]ethenyl]benzoate (PubChem CID 175151333) has the molecular formula C19H15F3N4O3 and a molecular weight of 404.35 g/mol. Its IUPAC name is methyl 2-amino-5-[2-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]ethenyl]benzoate.
| Compound Name | methyl 2-amino-5-[2-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]ethenyl]benzoate |
|---|---|
| PubChem CID | 175151333 |
| Molecular Formula | C19H15F3N4O3 |
| Molecular Weight | 404.35 g/mol |
| Exact Mass | 404.11 |
| IUPAC Name | methyl 2-amino-5-[2-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]ethenyl]benzoate |
| SMILES | COC(=O)c1cc(C=Cc2ncn(-c3ccc(OC(F)(F)F)cc3)n2)ccc1N |
| InChI | InChI=1S/C19H15F3N4O3/c1-28-18(27)15-10-12(2-8-16(15)23)3-9-17-24-11-26(25-17)13-4-6-14(7-5-13)29-19(20,21)22/h2-11H,23H2,1H3 |
| InChIKey | NUWKOWMCSOIQTJ-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.35 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|