C24H16F3N5O5 — CID 126643917
(4-nitrophenyl)-[4-[(E)-2-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]ethenyl]phenyl]carbamic acid (PubChem CID 126643917) has the molecular formula C24H16F3N5O5 and a molecular weight of 511.42 g/mol. Its IUPAC name is (4-nitrophenyl)-[4-[(E)-2-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]ethenyl]phenyl]carbamic acid.
| Compound Name | (4-nitrophenyl)-[4-[(E)-2-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]ethenyl]phenyl]carbamic acid |
|---|---|
| PubChem CID | 126643917 |
| Molecular Formula | C24H16F3N5O5 |
| Molecular Weight | 511.42 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | (4-nitrophenyl)-[4-[(E)-2-[1-[4-(trifluoromethoxy)phenyl]-1,2,4-triazol-3-yl]ethenyl]phenyl]carbamic acid |
| SMILES | O=C(O)N(c1ccc(/C=C/c2ncn(-c3ccc(OC(F)(F)F)cc3)n2)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C24H16F3N5O5/c25-24(26,27)37-21-12-10-17(11-13-21)30-15-28-22(29-30)14-3-16-1-4-18(5-2-16)31(23(33)34)19-6-8-20(9-7-19)32(35)36/h1-15H,(H,33,34)/b14-3+ |
| InChIKey | BAVWBIQDKOGMDI-LZWSPWQCSA-N |
| XLogP | 6.06 |
| TPSA | 123.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.42 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|