C17H13F3N6O4S — CID 36636214
N-methyl-N-(4-nitrophenyl)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylacetamide (PubChem CID 36636214) has the molecular formula C17H13F3N6O4S and a molecular weight of 454.39 g/mol. Its IUPAC name is N-methyl-N-(4-nitrophenyl)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylacetamide.
| Compound Name | N-methyl-N-(4-nitrophenyl)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 36636214 |
| Molecular Formula | C17H13F3N6O4S |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | N-methyl-N-(4-nitrophenyl)-2-[1-[4-(trifluoromethoxy)phenyl]tetrazol-5-yl]sulfanylacetamide |
| SMILES | CN(C(=O)CSc1nnnn1-c1ccc(OC(F)(F)F)cc1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H13F3N6O4S/c1-24(11-2-4-13(5-3-11)26(28)29)15(27)10-31-16-21-22-23-25(16)12-6-8-14(9-7-12)30-17(18,19)20/h2-9H,10H2,1H3 |
| InChIKey | IPJYFSIFKMECSZ-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 116.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|