C16H13N5O5S — CID 157046604
4-[5-[(2S)-2-hydroxy-2-(4-nitrophenyl)ethyl]sulfanyltetrazol-1-yl]benzoic acid (PubChem CID 157046604) has the molecular formula C16H13N5O5S and a molecular weight of 387.38 g/mol. Its IUPAC name is 4-[5-[(2S)-2-hydroxy-2-(4-nitrophenyl)ethyl]sulfanyltetrazol-1-yl]benzoic acid.
| Compound Name | 4-[5-[(2S)-2-hydroxy-2-(4-nitrophenyl)ethyl]sulfanyltetrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 157046604 |
| Molecular Formula | C16H13N5O5S |
| Molecular Weight | 387.38 g/mol |
| Exact Mass | 387.06 |
| IUPAC Name | 4-[5-[(2S)-2-hydroxy-2-(4-nitrophenyl)ethyl]sulfanyltetrazol-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-n2nnnc2SC[C@@H](O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C16H13N5O5S/c22-14(10-1-7-13(8-2-10)21(25)26)9-27-16-17-18-19-20(16)12-5-3-11(4-6-12)15(23)24/h1-8,14,22H,9H2,(H,23,24)/t14-/m1/s1 |
| InChIKey | NGIGDBVQVNDJAS-CQSZACIVSA-N |
| XLogP | 2.09 |
| TPSA | 144.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.38 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|