C19H19N5O3S — CID 162373364
4-[5-[2-[4-(cyclopropylamino)phenyl]-2-hydroxyethyl]sulfanyltetrazol-1-yl]benzoic acid (PubChem CID 162373364) has the molecular formula C19H19N5O3S and a molecular weight of 397.46 g/mol. Its IUPAC name is 4-[5-[2-[4-(cyclopropylamino)phenyl]-2-hydroxyethyl]sulfanyltetrazol-1-yl]benzoic acid.
| Compound Name | 4-[5-[2-[4-(cyclopropylamino)phenyl]-2-hydroxyethyl]sulfanyltetrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 162373364 |
| Molecular Formula | C19H19N5O3S |
| Molecular Weight | 397.46 g/mol |
| Exact Mass | 397.12 |
| IUPAC Name | 4-[5-[2-[4-(cyclopropylamino)phenyl]-2-hydroxyethyl]sulfanyltetrazol-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-n2nnnc2SCC(O)c2ccc(NC3CC3)cc2)cc1 |
| InChI | InChI=1S/C19H19N5O3S/c25-17(12-1-5-14(6-2-12)20-15-7-8-15)11-28-19-21-22-23-24(19)16-9-3-13(4-10-16)18(26)27/h1-6,9-10,15,17,20,25H,7-8,11H2,(H,26,27) |
| InChIKey | HYTIIMMUVDHSLG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 113.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.46 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |