C12H11N9O3S — CID 4623739
4-[5-[2-[(1-methyltetrazol-5-yl)amino]-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid (PubChem CID 4623739) has the molecular formula C12H11N9O3S and a molecular weight of 361.35 g/mol. Its IUPAC name is 4-[5-[2-[(1-methyltetrazol-5-yl)amino]-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid.
| Compound Name | 4-[5-[2-[(1-methyltetrazol-5-yl)amino]-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 4623739 |
| Molecular Formula | C12H11N9O3S |
| Molecular Weight | 361.35 g/mol |
| Exact Mass | 361.07 |
| IUPAC Name | 4-[5-[2-[(1-methyltetrazol-5-yl)amino]-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid |
| SMILES | Cn1nnnc1NC(=O)CSc1nnnn1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C12H11N9O3S/c1-20-11(14-16-18-20)13-9(22)6-25-12-15-17-19-21(12)8-4-2-7(3-5-8)10(23)24/h2-5H,6H2,1H3,(H,23,24)(H,13,14,18,22) |
| InChIKey | IXHMLOVKRMQLQC-UHFFFAOYSA-N |
| XLogP | -0.39 |
| TPSA | 153.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.35 |
| LogP ≤ 5 | -0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |