C14H16N6O3S — CID 146608678
4-[5-[3-methyl-4-(methyldiazenyl)-2-oxobutyl]sulfanyltetrazol-1-yl]benzoic acid (PubChem CID 146608678) has the molecular formula C14H16N6O3S and a molecular weight of 348.39 g/mol. Its IUPAC name is 4-[5-[3-methyl-4-(methyldiazenyl)-2-oxobutyl]sulfanyltetrazol-1-yl]benzoic acid.
| Compound Name | 4-[5-[3-methyl-4-(methyldiazenyl)-2-oxobutyl]sulfanyltetrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 146608678 |
| Molecular Formula | C14H16N6O3S |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.10 |
| IUPAC Name | 4-[5-[3-methyl-4-(methyldiazenyl)-2-oxobutyl]sulfanyltetrazol-1-yl]benzoic acid |
| SMILES | C/N=N/CC(C)C(=O)CSc1nnnn1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C14H16N6O3S/c1-9(7-16-15-2)12(21)8-24-14-17-18-19-20(14)11-5-3-10(4-6-11)13(22)23/h3-6,9H,7-8H2,1-2H3,(H,22,23)/b16-15+ |
| InChIKey | POEJZJCFGGCRRG-FOCLMDBBSA-N |
| XLogP | 1.74 |
| TPSA | 122.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|