C17H13ClN4O3S — CID 163711676
4-[5-[3-(3-chlorophenyl)-2-oxopropyl]sulfanyltetrazol-1-yl]benzoic acid (PubChem CID 163711676) has the molecular formula C17H13ClN4O3S and a molecular weight of 388.84 g/mol. Its IUPAC name is 4-[5-[3-(3-chlorophenyl)-2-oxopropyl]sulfanyltetrazol-1-yl]benzoic acid.
| Compound Name | 4-[5-[3-(3-chlorophenyl)-2-oxopropyl]sulfanyltetrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 163711676 |
| Molecular Formula | C17H13ClN4O3S |
| Molecular Weight | 388.84 g/mol |
| Exact Mass | 388.04 |
| IUPAC Name | 4-[5-[3-(3-chlorophenyl)-2-oxopropyl]sulfanyltetrazol-1-yl]benzoic acid |
| SMILES | O=C(CSc1nnnn1-c1ccc(C(=O)O)cc1)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C17H13ClN4O3S/c18-13-3-1-2-11(8-13)9-15(23)10-26-17-19-20-21-22(17)14-6-4-12(5-7-14)16(24)25/h1-8H,9-10H2,(H,24,25) |
| InChIKey | FQEOTMXJTAGFDC-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.84 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |