C9H9ClN4OS — CID 17437726
2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylethanol (PubChem CID 17437726) has the molecular formula C9H9ClN4OS and a molecular weight of 256.72 g/mol. Its IUPAC name is 2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylethanol.
| Compound Name | 2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylethanol |
|---|---|
| PubChem CID | 17437726 |
| Molecular Formula | C9H9ClN4OS |
| Molecular Weight | 256.72 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 2-[1-(3-chlorophenyl)tetrazol-5-yl]sulfanylethanol |
| SMILES | OCCSc1nnnn1-c1cccc(Cl)c1 |
| InChI | InChI=1S/C9H9ClN4OS/c10-7-2-1-3-8(6-7)14-9(11-12-13-14)16-5-4-15/h1-3,6,15H,4-5H2 |
| InChIKey | VSXOSSRBGHTPOE-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.72 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |