C18H12N4O4S2 — CID 56733859
4-[5-[2-(3-hydroxy-1-benzothiophen-2-yl)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid (PubChem CID 56733859) has the molecular formula C18H12N4O4S2 and a molecular weight of 412.45 g/mol. Its IUPAC name is 4-[5-[2-(3-hydroxy-1-benzothiophen-2-yl)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid.
| Compound Name | 4-[5-[2-(3-hydroxy-1-benzothiophen-2-yl)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 56733859 |
| Molecular Formula | C18H12N4O4S2 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.03 |
| IUPAC Name | 4-[5-[2-(3-hydroxy-1-benzothiophen-2-yl)-2-oxoethyl]sulfanyltetrazol-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-n2nnnc2SCC(=O)c2sc3ccccc3c2O)cc1 |
| InChI | InChI=1S/C18H12N4O4S2/c23-13(16-15(24)12-3-1-2-4-14(12)28-16)9-27-18-19-20-21-22(18)11-7-5-10(6-8-11)17(25)26/h1-8,24H,9H2,(H,25,26) |
| InChIKey | XOXYJSPVMKUQAS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 118.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|