C17H11N5O2S2 — CID 18708609
4-[5-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]benzoic acid (PubChem CID 18708609) has the molecular formula C17H11N5O2S2 and a molecular weight of 381.44 g/mol. Its IUPAC name is 4-[5-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]benzoic acid.
| Compound Name | 4-[5-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]benzoic acid |
|---|---|
| PubChem CID | 18708609 |
| Molecular Formula | C17H11N5O2S2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.04 |
| IUPAC Name | 4-[5-[(4-phenyl-1,3-thiazol-2-yl)sulfanyl]tetrazol-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-n2nnnc2Sc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C17H11N5O2S2/c23-15(24)12-6-8-13(9-7-12)22-16(19-20-21-22)26-17-18-14(10-25-17)11-4-2-1-3-5-11/h1-10H,(H,23,24) |
| InChIKey | MCPUCMYZMSFWEF-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |