C16H19N5O2S3 — CID 18707614
2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-4-phenyl-1,3-thiazole (PubChem CID 18707614) has the molecular formula C16H19N5O2S3 and a molecular weight of 409.56 g/mol. Its IUPAC name is 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-4-phenyl-1,3-thiazole.
| Compound Name | 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 18707614 |
| Molecular Formula | C16H19N5O2S3 |
| Molecular Weight | 409.56 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-4-phenyl-1,3-thiazole |
| SMILES | CS(=O)(=O)CCCCCn1nnnc1Sc1nc(-c2ccccc2)cs1 |
| InChI | InChI=1S/C16H19N5O2S3/c1-26(22,23)11-7-3-6-10-21-15(18-19-20-21)25-16-17-14(12-24-16)13-8-4-2-5-9-13/h2,4-5,8-9,12H,3,6-7,10-11H2,1H3 |
| InChIKey | WSCISKWJCXKXMK-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 90.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.56 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|