C11H9N5S2 — CID 18708988
4-methyl-2-(1-phenyltetrazol-5-yl)sulfanyl-1,3-thiazole (PubChem CID 18708988) has the molecular formula C11H9N5S2 and a molecular weight of 275.36 g/mol. Its IUPAC name is 4-methyl-2-(1-phenyltetrazol-5-yl)sulfanyl-1,3-thiazole.
| Compound Name | 4-methyl-2-(1-phenyltetrazol-5-yl)sulfanyl-1,3-thiazole |
|---|---|
| PubChem CID | 18708988 |
| Molecular Formula | C11H9N5S2 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.03 |
| IUPAC Name | 4-methyl-2-(1-phenyltetrazol-5-yl)sulfanyl-1,3-thiazole |
| SMILES | Cc1csc(Sc2nnnn2-c2ccccc2)n1 |
| InChI | InChI=1S/C11H9N5S2/c1-8-7-17-11(12-8)18-10-13-14-15-16(10)9-5-3-2-4-6-9/h2-7H,1H3 |
| InChIKey | MESKUOAQBSKSBT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |