C14H16N6O4S3 — CID 18708586
2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole (PubChem CID 18708586) has the molecular formula C14H16N6O4S3 and a molecular weight of 428.52 g/mol. Its IUPAC name is 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole.
| Compound Name | 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 18708586 |
| Molecular Formula | C14H16N6O4S3 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole |
| SMILES | CS(=O)(=O)CCCCCn1nnnc1Sc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C14H16N6O4S3/c1-27(23,24)8-4-2-3-7-19-13(16-17-18-19)26-14-15-11-6-5-10(20(21)22)9-12(11)25-14/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | VLGBDQFDXDEMGG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 133.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|