About 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole
2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole (PubChem CID 18708586) has the molecular formula C14H16N6O4S3
and a molecular weight of 428.52 g/mol. Its IUPAC name is 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole.
Molecular Properties
| Compound Name | 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole |
| PubChem CID | 18708586 |
| Molecular Formula | C14H16N6O4S3 |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.04 |
| IUPAC Name | 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole |
| SMILES | CS(=O)(=O)CCCCCn1nnnc1Sc1nc2ccc([N+](=O)[O-])cc2s1 |
| InChI | InChI=1S/C14H16N6O4S3/c1-27(23,24)8-4-2-3-7-19-13(16-17-18-19)26-14-15-11-6-5-10(20(21)22)9-12(11)25-14/h5-6,9H,2-4,7-8H2,1H3 |
| InChIKey | VLGBDQFDXDEMGG-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 133.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole?
The IUPAC name of 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole (CID 18708586) is 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole.
What is the SMILES notation for 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole?
The canonical SMILES for 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole is CS(=O)(=O)CCCCCn1nnnc1Sc1nc2ccc([N+](=O)[O-])cc2s1.
What is the InChIKey of 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole?
The InChIKey is VLGBDQFDXDEMGG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16N6O4S3/c1-27(23,24)8-4-2-3-7-19-13(16-17-18-19)26-14-15-11-6-5-10(20(21)22)9-12(11)25-14/h5-6,9H,2-4,7-8H2,1H3.
What are the key properties of 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole?
2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole has a molecular weight of 428.52 g/mol, XLogP of 2.56, 9 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[1-(5-methylsulfonylpentyl)tetrazol-5-yl]sulfanyl-6-nitro-1,3-benzothiazole is sourced from PubChem (CID 18708586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).