C13H7N7O2S2 — CID 18708275
6-nitro-2-(1-pyridin-3-yltetrazol-5-yl)sulfanyl-1,3-benzothiazole (PubChem CID 18708275) has the molecular formula C13H7N7O2S2 and a molecular weight of 357.38 g/mol. Its IUPAC name is 6-nitro-2-(1-pyridin-3-yltetrazol-5-yl)sulfanyl-1,3-benzothiazole.
| Compound Name | 6-nitro-2-(1-pyridin-3-yltetrazol-5-yl)sulfanyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 18708275 |
| Molecular Formula | C13H7N7O2S2 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.01 |
| IUPAC Name | 6-nitro-2-(1-pyridin-3-yltetrazol-5-yl)sulfanyl-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc2nc(Sc3nnnn3-c3cccnc3)sc2c1 |
| InChI | InChI=1S/C13H7N7O2S2/c21-20(22)8-3-4-10-11(6-8)23-13(15-10)24-12-16-17-18-19(12)9-2-1-5-14-7-9/h1-7H |
| InChIKey | HLCXHYHEDPOHFE-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 112.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|