C13H6N6O4S3 — CID 18709393
2-[1-(5-nitrothiophen-2-yl)tetrazol-5-yl]sulfanyl-1,3-benzothiazole-6-carboxylic acid (PubChem CID 18709393) has the molecular formula C13H6N6O4S3 and a molecular weight of 406.43 g/mol. Its IUPAC name is 2-[1-(5-nitrothiophen-2-yl)tetrazol-5-yl]sulfanyl-1,3-benzothiazole-6-carboxylic acid.
| Compound Name | 2-[1-(5-nitrothiophen-2-yl)tetrazol-5-yl]sulfanyl-1,3-benzothiazole-6-carboxylic acid |
|---|---|
| PubChem CID | 18709393 |
| Molecular Formula | C13H6N6O4S3 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 405.96 |
| IUPAC Name | 2-[1-(5-nitrothiophen-2-yl)tetrazol-5-yl]sulfanyl-1,3-benzothiazole-6-carboxylic acid |
| SMILES | O=C(O)c1ccc2nc(Sc3nnnn3-c3ccc([N+](=O)[O-])s3)sc2c1 |
| InChI | InChI=1S/C13H6N6O4S3/c20-11(21)6-1-2-7-8(5-6)24-13(14-7)26-12-15-16-17-18(12)9-3-4-10(25-9)19(22)23/h1-5H,(H,20,21) |
| InChIKey | OTGQLNQQUBTSSY-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 136.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|