About 4-[5-(1,3-thiazol-2-ylsulfanyl)tetrazol-1-yl]benzoic acid
4-[5-(1,3-thiazol-2-ylsulfanyl)tetrazol-1-yl]benzoic acid (PubChem CID 18709362) has the molecular formula C11H7N5O2S2
and a molecular weight of 305.34 g/mol. Its IUPAC name is 4-[5-(1,3-thiazol-2-ylsulfanyl)tetrazol-1-yl]benzoic acid.
Molecular Properties
| Compound Name | 4-[5-(1,3-thiazol-2-ylsulfanyl)tetrazol-1-yl]benzoic acid |
| PubChem CID | 18709362 |
| Molecular Formula | C11H7N5O2S2 |
| Molecular Weight | 305.34 g/mol |
| Exact Mass | 305.00 |
| IUPAC Name | 4-[5-(1,3-thiazol-2-ylsulfanyl)tetrazol-1-yl]benzoic acid |
| SMILES | O=C(O)c1ccc(-n2nnnc2Sc2nccs2)cc1 |
| InChI | InChI=1S/C11H7N5O2S2/c17-9(18)7-1-3-8(4-2-7)16-10(13-14-15-16)20-11-12-5-6-19-11/h1-6H,(H,17,18) |
| InChIKey | QMLYXXLXPRHGHN-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 93.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.34 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze 4-[5-(1,3-thiazol-2-ylsulfanyl)tetrazol-1-yl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[5-(1,3-thiazol-2-ylsulfanyl)tetrazol-1-yl]benzoic acid?
The IUPAC name of 4-[5-(1,3-thiazol-2-ylsulfanyl)tetrazol-1-yl]benzoic acid (CID 18709362) is 4-[5-(1,3-thiazol-2-ylsulfanyl)tetrazol-1-yl]benzoic acid.
What is the SMILES notation for 4-[5-(1,3-thiazol-2-ylsulfanyl)tetrazol-1-yl]benzoic acid?
The canonical SMILES for 4-[5-(1,3-thiazol-2-ylsulfanyl)tetrazol-1-yl]benzoic acid is O=C(O)c1ccc(-n2nnnc2Sc2nccs2)cc1.
What is the InChIKey of 4-[5-(1,3-thiazol-2-ylsulfanyl)tetrazol-1-yl]benzoic acid?
The InChIKey is QMLYXXLXPRHGHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7N5O2S2/c17-9(18)7-1-3-8(4-2-7)16-10(13-14-15-16)20-11-12-5-6-19-11/h1-6H,(H,17,18).
What are the key properties of 4-[5-(1,3-thiazol-2-ylsulfanyl)tetrazol-1-yl]benzoic acid?
4-[5-(1,3-thiazol-2-ylsulfanyl)tetrazol-1-yl]benzoic acid has a molecular weight of 305.34 g/mol, XLogP of 1.97, 4 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[5-(1,3-thiazol-2-ylsulfanyl)tetrazol-1-yl]benzoic acid is sourced from PubChem (CID 18709362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).