C12H11N5S2 — CID 70263093
2-[1-(2-ethylphenyl)tetrazol-5-yl]sulfanyl-1,3-thiazole (PubChem CID 70263093) has the molecular formula C12H11N5S2 and a molecular weight of 289.39 g/mol. Its IUPAC name is 2-[1-(2-ethylphenyl)tetrazol-5-yl]sulfanyl-1,3-thiazole.
| Compound Name | 2-[1-(2-ethylphenyl)tetrazol-5-yl]sulfanyl-1,3-thiazole |
|---|---|
| PubChem CID | 70263093 |
| Molecular Formula | C12H11N5S2 |
| Molecular Weight | 289.39 g/mol |
| Exact Mass | 289.05 |
| IUPAC Name | 2-[1-(2-ethylphenyl)tetrazol-5-yl]sulfanyl-1,3-thiazole |
| SMILES | CCc1ccccc1-n1nnnc1Sc1nccs1 |
| InChI | InChI=1S/C12H11N5S2/c1-2-9-5-3-4-6-10(9)17-11(14-15-16-17)19-12-13-7-8-18-12/h3-8H,2H2,1H3 |
| InChIKey | YUNYYAKTRRZQIS-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.39 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|