C9H8N4O4S2 — CID 18731462
4-(5-methylsulfonylsulfanyltetrazol-1-yl)benzoic acid (PubChem CID 18731462) has the molecular formula C9H8N4O4S2 and a molecular weight of 300.32 g/mol. Its IUPAC name is 4-(5-methylsulfonylsulfanyltetrazol-1-yl)benzoic acid.
| Compound Name | 4-(5-methylsulfonylsulfanyltetrazol-1-yl)benzoic acid |
|---|---|
| PubChem CID | 18731462 |
| Molecular Formula | C9H8N4O4S2 |
| Molecular Weight | 300.32 g/mol |
| Exact Mass | 300.00 |
| IUPAC Name | 4-(5-methylsulfonylsulfanyltetrazol-1-yl)benzoic acid |
| SMILES | CS(=O)(=O)Sc1nnnn1-c1ccc(C(=O)O)cc1 |
| InChI | InChI=1S/C9H8N4O4S2/c1-19(16,17)18-9-10-11-12-13(9)7-4-2-6(3-5-7)8(14)15/h2-5H,1H3,(H,14,15) |
| InChIKey | CVMMSSDDGCIMDN-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 115.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.32 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|