C14H9N5O2S3 — CID 18708812
2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-6-nitro-1,3-benzothiazole (PubChem CID 18708812) has the molecular formula C14H9N5O2S3 and a molecular weight of 375.46 g/mol. Its IUPAC name is 2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-6-nitro-1,3-benzothiazole.
| Compound Name | 2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-6-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 18708812 |
| Molecular Formula | C14H9N5O2S3 |
| Molecular Weight | 375.46 g/mol |
| Exact Mass | 374.99 |
| IUPAC Name | 2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-6-nitro-1,3-benzothiazole |
| SMILES | Cn1c(Sc2nc3ccc([N+](=O)[O-])cc3s2)nnc1-c1cccs1 |
| InChI | InChI=1S/C14H9N5O2S3/c1-18-12(10-3-2-6-22-10)16-17-13(18)24-14-15-9-5-4-8(19(20)21)7-11(9)23-14/h2-7H,1H3 |
| InChIKey | UEWRASZSOMQENP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.46 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|