C23H13N5O2S3 — CID 18707801
2-[[5-(1-benzothiophen-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-6-nitro-1,3-benzothiazole (PubChem CID 18707801) has the molecular formula C23H13N5O2S3 and a molecular weight of 487.59 g/mol. Its IUPAC name is 2-[[5-(1-benzothiophen-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-6-nitro-1,3-benzothiazole.
| Compound Name | 2-[[5-(1-benzothiophen-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-6-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 18707801 |
| Molecular Formula | C23H13N5O2S3 |
| Molecular Weight | 487.59 g/mol |
| Exact Mass | 487.02 |
| IUPAC Name | 2-[[5-(1-benzothiophen-2-yl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]-6-nitro-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc2nc(Sc3nnc(-c4cc5ccccc5s4)n3-c3ccccc3)sc2c1 |
| InChI | InChI=1S/C23H13N5O2S3/c29-28(30)16-10-11-17-19(13-16)32-23(24-17)33-22-26-25-21(27(22)15-7-2-1-3-8-15)20-12-14-6-4-5-9-18(14)31-20/h1-13H |
| InChIKey | FHEDKWMTHMIHRW-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.59 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|