C18H12N6O2S — CID 133467870
2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyrimidine (PubChem CID 133467870) has the molecular formula C18H12N6O2S and a molecular weight of 376.40 g/mol. Its IUPAC name is 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyrimidine.
| Compound Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyrimidine |
|---|---|
| PubChem CID | 133467870 |
| Molecular Formula | C18H12N6O2S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.07 |
| IUPAC Name | 2-[(4,5-diphenyl-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyrimidine |
| SMILES | O=[N+]([O-])c1cnc(Sc2nnc(-c3ccccc3)n2-c2ccccc2)nc1 |
| InChI | InChI=1S/C18H12N6O2S/c25-24(26)15-11-19-17(20-12-15)27-18-22-21-16(13-7-3-1-4-8-13)23(18)14-9-5-2-6-10-14/h1-12H |
| InChIKey | CIORGRXZRNXPAV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|