C11H8N6O2S2 — CID 133467749
2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyrimidine (PubChem CID 133467749) has the molecular formula C11H8N6O2S2 and a molecular weight of 320.36 g/mol. Its IUPAC name is 2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyrimidine.
| Compound Name | 2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyrimidine |
|---|---|
| PubChem CID | 133467749 |
| Molecular Formula | C11H8N6O2S2 |
| Molecular Weight | 320.36 g/mol |
| Exact Mass | 320.02 |
| IUPAC Name | 2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]-5-nitropyrimidine |
| SMILES | Cn1c(Sc2ncc([N+](=O)[O-])cn2)nnc1-c1cccs1 |
| InChI | InChI=1S/C11H8N6O2S2/c1-16-9(8-3-2-4-20-8)14-15-11(16)21-10-12-5-7(6-13-10)17(18)19/h2-6H,1H3 |
| InChIKey | SXDQMBYXJJZZKF-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 99.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|