C16H14N6O4S2 — CID 46661601
N'-[2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-3-nitrobenzohydrazide (PubChem CID 46661601) has the molecular formula C16H14N6O4S2 and a molecular weight of 418.46 g/mol. Its IUPAC name is N'-[2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 46661601 |
| Molecular Formula | C16H14N6O4S2 |
| Molecular Weight | 418.46 g/mol |
| Exact Mass | 418.05 |
| IUPAC Name | N'-[2-[(4-methyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-3-nitrobenzohydrazide |
| SMILES | Cn1c(SCC(=O)NNC(=O)c2cccc([N+](=O)[O-])c2)nnc1-c1cccs1 |
| InChI | InChI=1S/C16H14N6O4S2/c1-21-14(12-6-3-7-27-12)18-20-16(21)28-9-13(23)17-19-15(24)10-4-2-5-11(8-10)22(25)26/h2-8H,9H2,1H3,(H,17,23)(H,19,24) |
| InChIKey | SWNHFCTXXAMSMP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.46 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|