C16H13N5O5S2 — CID 46661567
N'-[2-(3-methyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanylacetyl]-3-nitrobenzohydrazide (PubChem CID 46661567) has the molecular formula C16H13N5O5S2 and a molecular weight of 419.44 g/mol. Its IUPAC name is N'-[2-(3-methyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanylacetyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[2-(3-methyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanylacetyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 46661567 |
| Molecular Formula | C16H13N5O5S2 |
| Molecular Weight | 419.44 g/mol |
| Exact Mass | 419.04 |
| IUPAC Name | N'-[2-(3-methyl-4-oxothieno[3,2-d]pyrimidin-2-yl)sulfanylacetyl]-3-nitrobenzohydrazide |
| SMILES | Cn1c(SCC(=O)NNC(=O)c2cccc([N+](=O)[O-])c2)nc2ccsc2c1=O |
| InChI | InChI=1S/C16H13N5O5S2/c1-20-15(24)13-11(5-6-27-13)17-16(20)28-8-12(22)18-19-14(23)9-3-2-4-10(7-9)21(25)26/h2-7H,8H2,1H3,(H,18,22)(H,19,23) |
| InChIKey | XRTNNFQXNHJNSX-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 136.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.44 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|