C19H19N5O4S2 — CID 33342433
3-methyl-2-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]sulfanylthieno[3,2-d]pyrimidin-4-one (PubChem CID 33342433) has the molecular formula C19H19N5O4S2 and a molecular weight of 445.53 g/mol. Its IUPAC name is 3-methyl-2-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]sulfanylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 3-methyl-2-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]sulfanylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 33342433 |
| Molecular Formula | C19H19N5O4S2 |
| Molecular Weight | 445.53 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | 3-methyl-2-[2-[4-(4-nitrophenyl)piperazin-1-yl]-2-oxoethyl]sulfanylthieno[3,2-d]pyrimidin-4-one |
| SMILES | Cn1c(SCC(=O)N2CCN(c3ccc([N+](=O)[O-])cc3)CC2)nc2ccsc2c1=O |
| InChI | InChI=1S/C19H19N5O4S2/c1-21-18(26)17-15(6-11-29-17)20-19(21)30-12-16(25)23-9-7-22(8-10-23)13-2-4-14(5-3-13)24(27)28/h2-6,11H,7-10,12H2,1H3 |
| InChIKey | LSQUWYAIKCHORP-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 101.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.53 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|