C18H16N6O5S — CID 30908386
N'-[2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-3-nitrobenzohydrazide (PubChem CID 30908386) has the molecular formula C18H16N6O5S and a molecular weight of 428.43 g/mol. Its IUPAC name is N'-[2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 30908386 |
| Molecular Formula | C18H16N6O5S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | N'-[2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-3-nitrobenzohydrazide |
| SMILES | C=CCn1c(SCC(=O)NNC(=O)c2cccc([N+](=O)[O-])c2)nnc1-c1ccco1 |
| InChI | InChI=1S/C18H16N6O5S/c1-2-8-23-16(14-7-4-9-29-14)20-22-18(23)30-11-15(25)19-21-17(26)12-5-3-6-13(10-12)24(27)28/h2-7,9-10H,1,8,11H2,(H,19,25)(H,21,26) |
| InChIKey | NTTGFWLGFWFSNA-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 145.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|