C18H17N5O4S — CID 41048366
(2R)-2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)propanamide (PubChem CID 41048366) has the molecular formula C18H17N5O4S and a molecular weight of 399.43 g/mol. Its IUPAC name is (2R)-2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)propanamide.
| Compound Name | (2R)-2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 41048366 |
| Molecular Formula | C18H17N5O4S |
| Molecular Weight | 399.43 g/mol |
| Exact Mass | 399.10 |
| IUPAC Name | (2R)-2-[[5-(furan-2-yl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)propanamide |
| SMILES | C=CCn1c(S[C@H](C)C(=O)Nc2cccc([N+](=O)[O-])c2)nnc1-c1ccco1 |
| InChI | InChI=1S/C18H17N5O4S/c1-3-9-22-16(15-8-5-10-27-15)20-21-18(22)28-12(2)17(24)19-13-6-4-7-14(11-13)23(25)26/h3-8,10-12H,1,9H2,2H3,(H,19,24)/t12-/m1/s1 |
| InChIKey | RHRVDUOFJXYEMQ-GFCCVEGCSA-N |
| XLogP | 3.75 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.43 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|