C16H15N5O4S — CID 2706362
(2S)-2-[[5-(furan-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)propanamide (PubChem CID 2706362) has the molecular formula C16H15N5O4S and a molecular weight of 373.39 g/mol. Its IUPAC name is (2S)-2-[[5-(furan-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)propanamide.
| Compound Name | (2S)-2-[[5-(furan-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 2706362 |
| Molecular Formula | C16H15N5O4S |
| Molecular Weight | 373.39 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | (2S)-2-[[5-(furan-2-yl)-4-methyl-1,2,4-triazol-3-yl]sulfanyl]-N-(3-nitrophenyl)propanamide |
| SMILES | C[C@H](Sc1nnc(-c2ccco2)n1C)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C16H15N5O4S/c1-10(15(22)17-11-5-3-6-12(9-11)21(23)24)26-16-19-18-14(20(16)2)13-7-4-8-25-13/h3-10H,1-2H3,(H,17,22)/t10-/m0/s1 |
| InChIKey | CQHRFKSFUKUWLM-JTQLQIEISA-N |
| XLogP | 3.10 |
| TPSA | 116.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.39 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|