C17H16N6O3S — CID 78763049
2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-nitrophenyl)propanamide (PubChem CID 78763049) has the molecular formula C17H16N6O3S and a molecular weight of 384.42 g/mol. Its IUPAC name is 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-nitrophenyl)propanamide.
| Compound Name | 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 78763049 |
| Molecular Formula | C17H16N6O3S |
| Molecular Weight | 384.42 g/mol |
| Exact Mass | 384.10 |
| IUPAC Name | 2-[(4-amino-5-phenyl-1,2,4-triazol-3-yl)sulfanyl]-N-(3-nitrophenyl)propanamide |
| SMILES | CC(Sc1nnc(-c2ccccc2)n1N)C(=O)Nc1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C17H16N6O3S/c1-11(16(24)19-13-8-5-9-14(10-13)23(25)26)27-17-21-20-15(22(17)18)12-6-3-2-4-7-12/h2-11H,18H2,1H3,(H,19,24) |
| InChIKey | MNIXLTSDNSSOLZ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.42 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|