C17H15FN6O3S — CID 7769926
(2S)-2-[[4-amino-5-(3-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)propanamide (PubChem CID 7769926) has the molecular formula C17H15FN6O3S and a molecular weight of 402.41 g/mol. Its IUPAC name is (2S)-2-[[4-amino-5-(3-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)propanamide.
| Compound Name | (2S)-2-[[4-amino-5-(3-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)propanamide |
|---|---|
| PubChem CID | 7769926 |
| Molecular Formula | C17H15FN6O3S |
| Molecular Weight | 402.41 g/mol |
| Exact Mass | 402.09 |
| IUPAC Name | (2S)-2-[[4-amino-5-(3-fluorophenyl)-1,2,4-triazol-3-yl]sulfanyl]-N-(2-nitrophenyl)propanamide |
| SMILES | C[C@H](Sc1nnc(-c2cccc(F)c2)n1N)C(=O)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H15FN6O3S/c1-10(16(25)20-13-7-2-3-8-14(13)24(26)27)28-17-22-21-15(23(17)19)11-5-4-6-12(18)9-11/h2-10H,19H2,1H3,(H,20,25)/t10-/m0/s1 |
| InChIKey | MVMFTFFJZICJGC-JTQLQIEISA-N |
| XLogP | 2.83 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.41 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|