C20H18N6O4S — CID 3572519
4-nitro-N'-[2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide (PubChem CID 3572519) has the molecular formula C20H18N6O4S and a molecular weight of 438.47 g/mol. Its IUPAC name is 4-nitro-N'-[2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide.
| Compound Name | 4-nitro-N'-[2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide |
|---|---|
| PubChem CID | 3572519 |
| Molecular Formula | C20H18N6O4S |
| Molecular Weight | 438.47 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 4-nitro-N'-[2-[(5-phenyl-4-prop-2-enyl-1,2,4-triazol-3-yl)sulfanyl]acetyl]benzohydrazide |
| SMILES | C=CCn1c(SCC(=O)NNC(=O)c2ccc([N+](=O)[O-])cc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C20H18N6O4S/c1-2-12-25-18(14-6-4-3-5-7-14)22-24-20(25)31-13-17(27)21-23-19(28)15-8-10-16(11-9-15)26(29)30/h2-11H,1,12-13H2,(H,21,27)(H,23,28) |
| InChIKey | CZHQFJDSUFQMOK-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.47 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|