C24H26FN5O2S — CID 16541154
N'-[2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-fluorobenzohydrazide (PubChem CID 16541154) has the molecular formula C24H26FN5O2S and a molecular weight of 467.57 g/mol. Its IUPAC name is N'-[2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-fluorobenzohydrazide.
| Compound Name | N'-[2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-fluorobenzohydrazide |
|---|---|
| PubChem CID | 16541154 |
| Molecular Formula | C24H26FN5O2S |
| Molecular Weight | 467.57 g/mol |
| Exact Mass | 467.18 |
| IUPAC Name | N'-[2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-fluorobenzohydrazide |
| SMILES | C=CCn1c(SCC(=O)NNC(=O)c2ccc(F)cc2)nnc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C24H26FN5O2S/c1-5-14-30-21(16-6-10-18(11-7-16)24(2,3)4)27-29-23(30)33-15-20(31)26-28-22(32)17-8-12-19(25)13-9-17/h5-13H,1,14-15H2,2-4H3,(H,26,31)(H,28,32) |
| InChIKey | KVWGZEWGGSAKAL-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 88.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.57 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|