C20H25N5OS — CID 4794524
2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-cyanoethyl)acetamide (PubChem CID 4794524) has the molecular formula C20H25N5OS and a molecular weight of 383.52 g/mol. Its IUPAC name is 2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-cyanoethyl)acetamide.
| Compound Name | 2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-cyanoethyl)acetamide |
|---|---|
| PubChem CID | 4794524 |
| Molecular Formula | C20H25N5OS |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.18 |
| IUPAC Name | 2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]-N-(2-cyanoethyl)acetamide |
| SMILES | C=CCn1c(SCC(=O)NCCC#N)nnc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C20H25N5OS/c1-5-13-25-18(15-7-9-16(10-8-15)20(2,3)4)23-24-19(25)27-14-17(26)22-12-6-11-21/h5,7-10H,1,6,12-14H2,2-4H3,(H,22,26) |
| InChIKey | VUWLSNMSEDVYDP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|