C25H28ClN5O3S — CID 16541142
N'-[2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-(4-chlorophenoxy)acetohydrazide (PubChem CID 16541142) has the molecular formula C25H28ClN5O3S and a molecular weight of 514.05 g/mol. Its IUPAC name is N'-[2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-(4-chlorophenoxy)acetohydrazide.
| Compound Name | N'-[2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-(4-chlorophenoxy)acetohydrazide |
|---|---|
| PubChem CID | 16541142 |
| Molecular Formula | C25H28ClN5O3S |
| Molecular Weight | 514.05 g/mol |
| Exact Mass | 513.16 |
| IUPAC Name | N'-[2-[[5-(4-tert-butylphenyl)-4-prop-2-enyl-1,2,4-triazol-3-yl]sulfanyl]acetyl]-2-(4-chlorophenoxy)acetohydrazide |
| SMILES | C=CCn1c(SCC(=O)NNC(=O)COc2ccc(Cl)cc2)nnc1-c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C25H28ClN5O3S/c1-5-14-31-23(17-6-8-18(9-7-17)25(2,3)4)29-30-24(31)35-16-22(33)28-27-21(32)15-34-20-12-10-19(26)11-13-20/h5-13H,1,14-16H2,2-4H3,(H,27,32)(H,28,33) |
| InChIKey | OULFXNLJTFUHQX-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.05 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|