C16H16N6O2S2 — CID 18162266
N'-[2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]pyridine-3-carbohydrazide (PubChem CID 18162266) has the molecular formula C16H16N6O2S2 and a molecular weight of 388.48 g/mol. Its IUPAC name is N'-[2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]pyridine-3-carbohydrazide.
| Compound Name | N'-[2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]pyridine-3-carbohydrazide |
|---|---|
| PubChem CID | 18162266 |
| Molecular Formula | C16H16N6O2S2 |
| Molecular Weight | 388.48 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | N'-[2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]pyridine-3-carbohydrazide |
| SMILES | CCn1c(SCC(=O)NNC(=O)c2cccnc2)nnc1-c1cccs1 |
| InChI | InChI=1S/C16H16N6O2S2/c1-2-22-14(12-6-4-8-25-12)19-21-16(22)26-10-13(23)18-20-15(24)11-5-3-7-17-9-11/h3-9H,2,10H2,1H3,(H,18,23)(H,20,24) |
| InChIKey | WFSPTWCUFYHDLO-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 101.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.48 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|