C20H19N7O2S2 — CID 4850300
N'-[2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-3-phenyl-1H-pyrazole-5-carbohydrazide (PubChem CID 4850300) has the molecular formula C20H19N7O2S2 and a molecular weight of 453.55 g/mol. Its IUPAC name is N'-[2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-3-phenyl-1H-pyrazole-5-carbohydrazide.
| Compound Name | N'-[2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-3-phenyl-1H-pyrazole-5-carbohydrazide |
|---|---|
| PubChem CID | 4850300 |
| Molecular Formula | C20H19N7O2S2 |
| Molecular Weight | 453.55 g/mol |
| Exact Mass | 453.10 |
| IUPAC Name | N'-[2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-3-phenyl-1H-pyrazole-5-carbohydrazide |
| SMILES | CCn1c(SCC(=O)NNC(=O)c2cc(-c3ccccc3)n[nH]2)nnc1-c1cccs1 |
| InChI | InChI=1S/C20H19N7O2S2/c1-2-27-18(16-9-6-10-30-16)24-26-20(27)31-12-17(28)23-25-19(29)15-11-14(21-22-15)13-7-4-3-5-8-13/h3-11H,2,12H2,1H3,(H,21,22)(H,23,28)(H,25,29) |
| InChIKey | JEWBQMIJGVWPJL-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.55 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|