C20H18N6O3S2 — CID 35954140
N'-[2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-5-phenyl-1,2-oxazole-3-carbohydrazide (PubChem CID 35954140) has the molecular formula C20H18N6O3S2 and a molecular weight of 454.54 g/mol. Its IUPAC name is N'-[2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-5-phenyl-1,2-oxazole-3-carbohydrazide.
| Compound Name | N'-[2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-5-phenyl-1,2-oxazole-3-carbohydrazide |
|---|---|
| PubChem CID | 35954140 |
| Molecular Formula | C20H18N6O3S2 |
| Molecular Weight | 454.54 g/mol |
| Exact Mass | 454.09 |
| IUPAC Name | N'-[2-[(4-ethyl-5-thiophen-2-yl-1,2,4-triazol-3-yl)sulfanyl]acetyl]-5-phenyl-1,2-oxazole-3-carbohydrazide |
| SMILES | CCn1c(SCC(=O)NNC(=O)c2cc(-c3ccccc3)on2)nnc1-c1cccs1 |
| InChI | InChI=1S/C20H18N6O3S2/c1-2-26-18(16-9-6-10-30-16)22-24-20(26)31-12-17(27)21-23-19(28)14-11-15(29-25-14)13-7-4-3-5-8-13/h3-11H,2,12H2,1H3,(H,21,27)(H,23,28) |
| InChIKey | XBPIKAGMVFEQIS-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 114.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.54 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|