C19H13N2O3PS — CID 162407002
2-diphenylphosphoryl-6-nitro-1,3-benzothiazole (PubChem CID 162407002) has the molecular formula C19H13N2O3PS and a molecular weight of 380.37 g/mol. Its IUPAC name is 2-diphenylphosphoryl-6-nitro-1,3-benzothiazole.
| Compound Name | 2-diphenylphosphoryl-6-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 162407002 |
| Molecular Formula | C19H13N2O3PS |
| Molecular Weight | 380.37 g/mol |
| Exact Mass | 380.04 |
| IUPAC Name | 2-diphenylphosphoryl-6-nitro-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc2nc(P(=O)(c3ccccc3)c3ccccc3)sc2c1 |
| InChI | InChI=1S/C19H13N2O3PS/c22-21(23)14-11-12-17-18(13-14)26-19(20-17)25(24,15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-13H |
| InChIKey | HUNWWBRBKARLPV-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 73.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.37 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|