C17H13N5O2S3 — CID 56575271
2-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-6-nitro-1,3-benzothiazole (PubChem CID 56575271) has the molecular formula C17H13N5O2S3 and a molecular weight of 415.53 g/mol. Its IUPAC name is 2-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-6-nitro-1,3-benzothiazole.
| Compound Name | 2-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-6-nitro-1,3-benzothiazole |
|---|---|
| PubChem CID | 56575271 |
| Molecular Formula | C17H13N5O2S3 |
| Molecular Weight | 415.53 g/mol |
| Exact Mass | 415.02 |
| IUPAC Name | 2-[[4-cyclopropyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]-6-nitro-1,3-benzothiazole |
| SMILES | O=[N+]([O-])c1ccc2nc(Sc3nnc(Cc4cccs4)n3C3CC3)sc2c1 |
| InChI | InChI=1S/C17H13N5O2S3/c23-22(24)11-5-6-13-14(8-11)26-17(18-13)27-16-20-19-15(21(16)10-3-4-10)9-12-2-1-7-25-12/h1-2,5-8,10H,3-4,9H2 |
| InChIKey | AHOSTMJKOCQDTK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.53 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|