C22H24N6O4S2 — CID 3878755
N'-[2-[[4-cyclohexyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-nitrobenzohydrazide (PubChem CID 3878755) has the molecular formula C22H24N6O4S2 and a molecular weight of 500.61 g/mol. Its IUPAC name is N'-[2-[[4-cyclohexyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-nitrobenzohydrazide.
| Compound Name | N'-[2-[[4-cyclohexyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-nitrobenzohydrazide |
|---|---|
| PubChem CID | 3878755 |
| Molecular Formula | C22H24N6O4S2 |
| Molecular Weight | 500.61 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | N'-[2-[[4-cyclohexyl-5-(thiophen-2-ylmethyl)-1,2,4-triazol-3-yl]sulfanyl]acetyl]-4-nitrobenzohydrazide |
| SMILES | O=C(CSc1nnc(Cc2cccs2)n1C1CCCCC1)NNC(=O)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H24N6O4S2/c29-20(24-25-21(30)15-8-10-17(11-9-15)28(31)32)14-34-22-26-23-19(13-18-7-4-12-33-18)27(22)16-5-2-1-3-6-16/h4,7-12,16H,1-3,5-6,13-14H2,(H,24,29)(H,25,30) |
| InChIKey | HIMCGLYIEDIRNV-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 132.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.61 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|