C17H13N5S2 — CID 18708946
2-(1-benzyltetrazol-5-yl)sulfanyl-4-phenyl-1,3-thiazole (PubChem CID 18708946) has the molecular formula C17H13N5S2 and a molecular weight of 351.46 g/mol. Its IUPAC name is 2-(1-benzyltetrazol-5-yl)sulfanyl-4-phenyl-1,3-thiazole.
| Compound Name | 2-(1-benzyltetrazol-5-yl)sulfanyl-4-phenyl-1,3-thiazole |
|---|---|
| PubChem CID | 18708946 |
| Molecular Formula | C17H13N5S2 |
| Molecular Weight | 351.46 g/mol |
| Exact Mass | 351.06 |
| IUPAC Name | 2-(1-benzyltetrazol-5-yl)sulfanyl-4-phenyl-1,3-thiazole |
| SMILES | c1ccc(Cn2nnnc2Sc2nc(-c3ccccc3)cs2)cc1 |
| InChI | InChI=1S/C17H13N5S2/c1-3-7-13(8-4-1)11-22-16(19-20-21-22)24-17-18-15(12-23-17)14-9-5-2-6-10-14/h1-10,12H,11H2 |
| InChIKey | XGVOHEMYMCJXPP-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 56.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.46 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |